C9H8NO3S- — CID 18764768
3-oxo-2-(sulfinatoamino)-1,2-dihydroindene (PubChem CID 18764768) has the molecular formula C9H8NO3S- and a molecular weight of 210.23 g/mol. Its IUPAC name is 3-oxo-2-(sulfinatoamino)-1,2-dihydroindene.
| Compound Name | 3-oxo-2-(sulfinatoamino)-1,2-dihydroindene |
|---|---|
| PubChem CID | 18764768 |
| Molecular Formula | C9H8NO3S- |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 3-oxo-2-(sulfinatoamino)-1,2-dihydroindene |
| SMILES | O=C1c2ccccc2CC1NS(=O)[O-] |
| InChI | InChI=1S/C9H9NO3S/c11-9-7-4-2-1-3-6(7)5-8(9)10-14(12)13/h1-4,8,10H,5H2,(H,12,13)/p-1 |
| InChIKey | FMZQBDJUGJMZJG-UHFFFAOYSA-M |
| XLogP | 0.18 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|