C15H16N2 — CID 176872171
(2S)-1-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 176872171) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is (2S)-1-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | (2S)-1-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 176872171 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (2S)-1-pyridin-3-yl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | N[C@H]1CCc2ccccc2C1c1cccnc1 |
| InChI | InChI=1S/C15H16N2/c16-14-8-7-11-4-1-2-6-13(11)15(14)12-5-3-9-17-10-12/h1-6,9-10,14-15H,7-8,16H2/t14-,15?/m0/s1 |
| InChIKey | UOPHGOQVUCYAEE-MLCCFXAWSA-N |
| XLogP | 2.49 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |