C16H18N2 — CID 81407153
N-[(1R)-1-pyridin-3-ylethyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 81407153) has the molecular formula C16H18N2 and a molecular weight of 238.33 g/mol. Its IUPAC name is N-[(1R)-1-pyridin-3-ylethyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[(1R)-1-pyridin-3-ylethyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 81407153 |
| Molecular Formula | C16H18N2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-[(1R)-1-pyridin-3-ylethyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | C[C@@H](NC1CCc2ccccc21)c1cccnc1 |
| InChI | InChI=1S/C16H18N2/c1-12(14-6-4-10-17-11-14)18-16-9-8-13-5-2-3-7-15(13)16/h2-7,10-12,16,18H,8-9H2,1H3/t12-,16?/m1/s1 |
| InChIKey | OYXPWMOWZKYZHB-ZGTOLYCTSA-N |
| XLogP | 3.42 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |