C17H17F2N — CID 43204034
N-[1-(3,4-difluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine (PubChem CID 43204034) has the molecular formula C17H17F2N and a molecular weight of 273.33 g/mol. Its IUPAC name is N-[1-(3,4-difluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine.
| Compound Name | N-[1-(3,4-difluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 43204034 |
| Molecular Formula | C17H17F2N |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N-[1-(3,4-difluorophenyl)ethyl]-2,3-dihydro-1H-inden-1-amine |
| SMILES | CC(NC1CCc2ccccc21)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C17H17F2N/c1-11(13-6-8-15(18)16(19)10-13)20-17-9-7-12-4-2-3-5-14(12)17/h2-6,8,10-11,17,20H,7,9H2,1H3 |
| InChIKey | ZVRNXVBSIKXWPO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |