C9H12N2O — CID 124511858
(2S,3S)-2-pyridin-3-yloxolan-3-amine (PubChem CID 124511858) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is (2S,3S)-2-pyridin-3-yloxolan-3-amine.
| Compound Name | (2S,3S)-2-pyridin-3-yloxolan-3-amine |
|---|---|
| PubChem CID | 124511858 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | (2S,3S)-2-pyridin-3-yloxolan-3-amine |
| SMILES | N[C@H]1CCO[C@H]1c1cccnc1 |
| InChI | InChI=1S/C9H12N2O/c10-8-3-5-12-9(8)7-2-1-4-11-6-7/h1-2,4,6,8-9H,3,5,10H2/t8-,9-/m0/s1 |
| InChIKey | LYPUGHDFPYWKIG-IUCAKERBSA-N |
| XLogP | 0.87 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |