C19H22N2O — CID 138045902
(2S,3R)-2-[5-(3-cyclobutylphenyl)-3-pyridinyl]oxolan-3-amine (PubChem CID 138045902) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (2S,3R)-2-[5-(3-cyclobutylphenyl)-3-pyridinyl]oxolan-3-amine.
| Compound Name | (2S,3R)-2-[5-(3-cyclobutylphenyl)-3-pyridinyl]oxolan-3-amine |
|---|---|
| PubChem CID | 138045902 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (2S,3R)-2-[5-(3-cyclobutylphenyl)-3-pyridinyl]oxolan-3-amine |
| SMILES | N[C@@H]1CCO[C@H]1c1cncc(-c2cccc(C3CCC3)c2)c1 |
| InChI | InChI=1S/C19H22N2O/c20-18-7-8-22-19(18)17-10-16(11-21-12-17)15-6-2-5-14(9-15)13-3-1-4-13/h2,5-6,9-13,18-19H,1,3-4,7-8,20H2/t18-,19+/m1/s1 |
| InChIKey | GHJAFYMVMVANFG-MOPGFXCFSA-N |
| XLogP | 3.80 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |