C28H43ClN2O2 — CID 155526154
4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]-1-pyridin-3-ylbutan-1-ol;hydrochloride (PubChem CID 155526154) has the molecular formula C28H43ClN2O2 and a molecular weight of 475.12 g/mol. Its IUPAC name is 4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]-1-pyridin-3-ylbutan-1-ol;hydrochloride.
| Compound Name | 4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]-1-pyridin-3-ylbutan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 155526154 |
| Molecular Formula | C28H43ClN2O2 |
| Molecular Weight | 475.12 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 4-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]-1-pyridin-3-ylbutan-1-ol;hydrochloride |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCC(O)c2cccnc2)cc1.Cl |
| InChI | InChI=1S/C28H42N2O2.ClH/c1-2-3-4-5-6-7-10-23-13-15-24(16-14-23)26-17-19-30-27(26)22-32-20-9-12-28(31)25-11-8-18-29-21-25;/h8,11,13-16,18,21,26-28,30-31H,2-7,9-10,12,17,19-20,22H2,1H3;1H/t26-,27-,28?;/m1./s1 |
| InChIKey | TWAKRWVZJQOQAV-UWAWSIKCSA-N |
| XLogP | 6.38 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.12 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|