C20H32Cl2N4O4S — CID 45261521
(1R)-2-[[1-[4-(2-methoxyethylsulfamoylamino)phenyl]-2-methylpropan-2-yl]amino]-1-pyridin-3-ylethanol;dihydrochloride (PubChem CID 45261521) has the molecular formula C20H32Cl2N4O4S and a molecular weight of 495.47 g/mol. Its IUPAC name is (1R)-2-[[1-[4-(2-methoxyethylsulfamoylamino)phenyl]-2-methylpropan-2-yl]amino]-1-pyridin-3-ylethanol;dihydrochloride.
| Compound Name | (1R)-2-[[1-[4-(2-methoxyethylsulfamoylamino)phenyl]-2-methylpropan-2-yl]amino]-1-pyridin-3-ylethanol;dihydrochloride |
|---|---|
| PubChem CID | 45261521 |
| Molecular Formula | C20H32Cl2N4O4S |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (1R)-2-[[1-[4-(2-methoxyethylsulfamoylamino)phenyl]-2-methylpropan-2-yl]amino]-1-pyridin-3-ylethanol;dihydrochloride |
| SMILES | COCCNS(=O)(=O)Nc1ccc(CC(C)(C)NC[C@H](O)c2cccnc2)cc1.Cl.Cl |
| InChI | InChI=1S/C20H30N4O4S.2ClH/c1-20(2,22-15-19(25)17-5-4-10-21-14-17)13-16-6-8-18(9-7-16)24-29(26,27)23-11-12-28-3;;/h4-10,14,19,22-25H,11-13,15H2,1-3H3;2*1H/t19-;;/m0../s1 |
| InChIKey | MDDZSFACWZXOOC-TXEPZDRESA-N |
| XLogP | 2.46 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|