C15H14N2O — CID 129404885
(3R)-3-pyridin-3-yl-1,3,4,5-tetrahydro-1-benzazepin-2-one (PubChem CID 129404885) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is (3R)-3-pyridin-3-yl-1,3,4,5-tetrahydro-1-benzazepin-2-one.
| Compound Name | (3R)-3-pyridin-3-yl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
|---|---|
| PubChem CID | 129404885 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (3R)-3-pyridin-3-yl-1,3,4,5-tetrahydro-1-benzazepin-2-one |
| SMILES | O=C1Nc2ccccc2CC[C@@H]1c1cccnc1 |
| InChI | InChI=1S/C15H14N2O/c18-15-13(12-5-3-9-16-10-12)8-7-11-4-1-2-6-14(11)17-15/h1-6,9-10,13H,7-8H2,(H,17,18)/t13-/m1/s1 |
| InChIKey | OTHXPJMRFVIBCY-CYBMUJFWSA-N |
| XLogP | 2.75 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |