C17H17NO — CID 11845488
1-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalene-1-carbaldehyde (PubChem CID 11845488) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalene-1-carbaldehyde.
| Compound Name | 1-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalene-1-carbaldehyde |
|---|---|
| PubChem CID | 11845488 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 1-methyl-2-pyridin-3-yl-3,4-dihydro-2H-naphthalene-1-carbaldehyde |
| SMILES | CC1(C=O)c2ccccc2CCC1c1cccnc1 |
| InChI | InChI=1S/C17H17NO/c1-17(12-19)15-7-3-2-5-13(15)8-9-16(17)14-6-4-10-18-11-14/h2-7,10-12,16H,8-9H2,1H3 |
| InChIKey | OXDKULXCOFPBAH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|