C13H17NO — CID 165497054
4,4-dimethyl-3-pyridin-3-ylcyclohexan-1-one (PubChem CID 165497054) has the molecular formula C13H17NO and a molecular weight of 203.29 g/mol. Its IUPAC name is 4,4-dimethyl-3-pyridin-3-ylcyclohexan-1-one.
| Compound Name | 4,4-dimethyl-3-pyridin-3-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 165497054 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4,4-dimethyl-3-pyridin-3-ylcyclohexan-1-one |
| SMILES | CC1(C)CCC(=O)CC1c1cccnc1 |
| InChI | InChI=1S/C13H17NO/c1-13(2)6-5-11(15)8-12(13)10-4-3-7-14-9-10/h3-4,7,9,12H,5-6,8H2,1-2H3 |
| InChIKey | XWMNLZFUAFCSBW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |