C16H13ClF2N2O — CID 142452969
6-chloro-6-(2,6-difluorophenyl)-5-pyridin-3-ylpiperidin-2-one (PubChem CID 142452969) has the molecular formula C16H13ClF2N2O and a molecular weight of 322.74 g/mol. Its IUPAC name is 6-chloro-6-(2,6-difluorophenyl)-5-pyridin-3-ylpiperidin-2-one.
| Compound Name | 6-chloro-6-(2,6-difluorophenyl)-5-pyridin-3-ylpiperidin-2-one |
|---|---|
| PubChem CID | 142452969 |
| Molecular Formula | C16H13ClF2N2O |
| Molecular Weight | 322.74 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 6-chloro-6-(2,6-difluorophenyl)-5-pyridin-3-ylpiperidin-2-one |
| SMILES | O=C1CCC(c2cccnc2)C(Cl)(c2c(F)cccc2F)N1 |
| InChI | InChI=1S/C16H13ClF2N2O/c17-16(15-12(18)4-1-5-13(15)19)11(6-7-14(22)21-16)10-3-2-8-20-9-10/h1-5,8-9,11H,6-7H2,(H,21,22) |
| InChIKey | DLDBTHYLSMHUBY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|