C13H12N2OS — CID 15309314
(4S,5S)-5-pyridin-3-yl-4-thiophen-2-ylpyrrolidin-2-one (PubChem CID 15309314) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is (4S,5S)-5-pyridin-3-yl-4-thiophen-2-ylpyrrolidin-2-one.
| Compound Name | (4S,5S)-5-pyridin-3-yl-4-thiophen-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 15309314 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (4S,5S)-5-pyridin-3-yl-4-thiophen-2-ylpyrrolidin-2-one |
| SMILES | O=C1C[C@H](c2cccs2)[C@@H](c2cccnc2)N1 |
| InChI | InChI=1S/C13H12N2OS/c16-12-7-10(11-4-2-6-17-11)13(15-12)9-3-1-5-14-8-9/h1-6,8,10,13H,7H2,(H,15,16)/t10-,13-/m1/s1 |
| InChIKey | JQZKAVOQHOUIFZ-ZWNOBZJWSA-N |
| XLogP | 2.49 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |