C11H15N2O+ — CID 14767414
1,1-dimethyl-5-pyridin-3-ylpyrrolidin-1-ium-2-one (PubChem CID 14767414) has the molecular formula C11H15N2O+ and a molecular weight of 191.25 g/mol. Its IUPAC name is 1,1-dimethyl-5-pyridin-3-ylpyrrolidin-1-ium-2-one.
| Compound Name | 1,1-dimethyl-5-pyridin-3-ylpyrrolidin-1-ium-2-one |
|---|---|
| PubChem CID | 14767414 |
| Molecular Formula | C11H15N2O+ |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1,1-dimethyl-5-pyridin-3-ylpyrrolidin-1-ium-2-one |
| SMILES | C[N+]1(C)C(=O)CCC1c1cccnc1 |
| InChI | InChI=1S/C11H15N2O/c1-13(2)10(5-6-11(13)14)9-4-3-7-12-8-9/h3-4,7-8,10H,5-6H2,1-2H3/q+1 |
| InChIKey | LMQQBEIHWDZSJK-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|