C10H10N2O — CID 174858264
3-pyridin-3-yl-3,4-dihydro-2H-pyridin-5-one (PubChem CID 174858264) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-pyridin-3-yl-3,4-dihydro-2H-pyridin-5-one.
| Compound Name | 3-pyridin-3-yl-3,4-dihydro-2H-pyridin-5-one |
|---|---|
| PubChem CID | 174858264 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 3-pyridin-3-yl-3,4-dihydro-2H-pyridin-5-one |
| SMILES | O=C1C=NCC(c2cccnc2)C1 |
| InChI | InChI=1S/C10H10N2O/c13-10-4-9(6-12-7-10)8-2-1-3-11-5-8/h1-3,5,7,9H,4,6H2 |
| InChIKey | CLNDNBQMDOHOMG-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |