C12H16N2O — CID 129301457
1-(4-pyridin-3-ylpiperidin-1-yl)ethanone (PubChem CID 129301457) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1-(4-pyridin-3-ylpiperidin-1-yl)ethanone.
| Compound Name | 1-(4-pyridin-3-ylpiperidin-1-yl)ethanone |
|---|---|
| PubChem CID | 129301457 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-(4-pyridin-3-ylpiperidin-1-yl)ethanone |
| SMILES | CC(=O)N1CCC(c2cccnc2)CC1 |
| InChI | InChI=1S/C12H16N2O/c1-10(15)14-7-4-11(5-8-14)12-3-2-6-13-9-12/h2-3,6,9,11H,4-5,7-8H2,1H3 |
| InChIKey | KGSHRLDQTHFKIA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |