C23H29N3O — CID 174853959
2-methyl-1-[4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]propan-1-one (PubChem CID 174853959) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-methyl-1-[4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 174853959 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 2-methyl-1-[4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]propan-1-one |
| SMILES | CC(C)C(=O)N1CCC(c2ccc(N3CC(c4cccnc4)C3)cc2)CC1 |
| InChI | InChI=1S/C23H29N3O/c1-17(2)23(27)25-12-9-19(10-13-25)18-5-7-22(8-6-18)26-15-21(16-26)20-4-3-11-24-14-20/h3-8,11,14,17,19,21H,9-10,12-13,15-16H2,1-2H3 |
| InChIKey | INTINOHEXAAGNS-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|