C15H22N2O2 — CID 176811840
1-[4-(3-methoxy-2-pyridinyl)piperidin-1-yl]-2-methylpropan-1-one (PubChem CID 176811840) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 1-[4-(3-methoxy-2-pyridinyl)piperidin-1-yl]-2-methylpropan-1-one.
| Compound Name | 1-[4-(3-methoxy-2-pyridinyl)piperidin-1-yl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 176811840 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 1-[4-(3-methoxy-2-pyridinyl)piperidin-1-yl]-2-methylpropan-1-one |
| SMILES | COc1cccnc1C1CCN(C(=O)C(C)C)CC1 |
| InChI | InChI=1S/C15H22N2O2/c1-11(2)15(18)17-9-6-12(7-10-17)14-13(19-3)5-4-8-16-14/h4-5,8,11-12H,6-7,9-10H2,1-3H3 |
| InChIKey | BMCPWFRSHAQSSJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |