C21H21N5O3 — CID 95822355
[4-[3-(2-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 95822355) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is [4-[3-(2-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [4-[3-(2-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 95822355 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | [4-[3-(2-methoxyphenoxy)pyrazin-2-yl]piperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | COc1ccccc1Oc1nccnc1C1CCN(C(=O)c2cnccn2)CC1 |
| InChI | InChI=1S/C21H21N5O3/c1-28-17-4-2-3-5-18(17)29-20-19(24-10-11-25-20)15-6-12-26(13-7-15)21(27)16-14-22-8-9-23-16/h2-5,8-11,14-15H,6-7,12-13H2,1H3 |
| InChIKey | GUGVQITVSGNGQN-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 90.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |