C13H15F3N2O3 — CID 118108096
[4-(3-methoxy-2-pyridinyl)piperidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 118108096) has the molecular formula C13H15F3N2O3 and a molecular weight of 304.27 g/mol. Its IUPAC name is [4-(3-methoxy-2-pyridinyl)piperidin-1-yl] 2,2,2-trifluoroacetate.
| Compound Name | [4-(3-methoxy-2-pyridinyl)piperidin-1-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118108096 |
| Molecular Formula | C13H15F3N2O3 |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | [4-(3-methoxy-2-pyridinyl)piperidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | COc1cccnc1C1CCN(OC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H15F3N2O3/c1-20-10-3-2-6-17-11(10)9-4-7-18(8-5-9)21-12(19)13(14,15)16/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | QPXNGWIUJYAGID-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |