C23H24N4OS — CID 174853962
[4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]-(1,3-thiazol-2-yl)methanone (PubChem CID 174853962) has the molecular formula C23H24N4OS and a molecular weight of 404.54 g/mol. Its IUPAC name is [4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]-(1,3-thiazol-2-yl)methanone.
| Compound Name | [4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]-(1,3-thiazol-2-yl)methanone |
|---|---|
| PubChem CID | 174853962 |
| Molecular Formula | C23H24N4OS |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | [4-[4-(3-pyridin-3-ylazetidin-1-yl)phenyl]piperidin-1-yl]-(1,3-thiazol-2-yl)methanone |
| SMILES | O=C(c1nccs1)N1CCC(c2ccc(N3CC(c4cccnc4)C3)cc2)CC1 |
| InChI | InChI=1S/C23H24N4OS/c28-23(22-25-10-13-29-22)26-11-7-18(8-12-26)17-3-5-21(6-4-17)27-15-20(16-27)19-2-1-9-24-14-19/h1-6,9-10,13-14,18,20H,7-8,11-12,15-16H2 |
| InChIKey | BAUURTFJBZFIHX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|