C16H15IN2O — CID 96537371
(4-iodophenyl)-[(3R)-3-pyridin-3-ylpyrrolidin-1-yl]methanone (PubChem CID 96537371) has the molecular formula C16H15IN2O and a molecular weight of 378.21 g/mol. Its IUPAC name is (4-iodophenyl)-[(3R)-3-pyridin-3-ylpyrrolidin-1-yl]methanone.
| Compound Name | (4-iodophenyl)-[(3R)-3-pyridin-3-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 96537371 |
| Molecular Formula | C16H15IN2O |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | (4-iodophenyl)-[(3R)-3-pyridin-3-ylpyrrolidin-1-yl]methanone |
| SMILES | O=C(c1ccc(I)cc1)N1CC[C@H](c2cccnc2)C1 |
| InChI | InChI=1S/C16H15IN2O/c17-15-5-3-12(4-6-15)16(20)19-9-7-14(11-19)13-2-1-8-18-10-13/h1-6,8,10,14H,7,9,11H2/t14-/m0/s1 |
| InChIKey | NWGDNFJSVHTORE-AWEZNQCLSA-N |
| XLogP | 3.32 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|