C24H21F3N2O2 — CID 46846478
(3-pyridin-3-ylpyrrolidin-1-yl)-[4-[4-(trifluoromethoxymethyl)phenyl]phenyl]methanone (PubChem CID 46846478) has the molecular formula C24H21F3N2O2 and a molecular weight of 426.44 g/mol. Its IUPAC name is (3-pyridin-3-ylpyrrolidin-1-yl)-[4-[4-(trifluoromethoxymethyl)phenyl]phenyl]methanone.
| Compound Name | (3-pyridin-3-ylpyrrolidin-1-yl)-[4-[4-(trifluoromethoxymethyl)phenyl]phenyl]methanone |
|---|---|
| PubChem CID | 46846478 |
| Molecular Formula | C24H21F3N2O2 |
| Molecular Weight | 426.44 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (3-pyridin-3-ylpyrrolidin-1-yl)-[4-[4-(trifluoromethoxymethyl)phenyl]phenyl]methanone |
| SMILES | O=C(c1ccc(-c2ccc(COC(F)(F)F)cc2)cc1)N1CCC(c2cccnc2)C1 |
| InChI | InChI=1S/C24H21F3N2O2/c25-24(26,27)31-16-17-3-5-18(6-4-17)19-7-9-20(10-8-19)23(30)29-13-11-22(15-29)21-2-1-12-28-14-21/h1-10,12,14,22H,11,13,15-16H2 |
| InChIKey | CBQWYQRSKKZWBM-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |