C26H28N2O2 — CID 67435954
[4-(4-ethoxy-3-methylphenyl)-2-methylphenyl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone (PubChem CID 67435954) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is [4-(4-ethoxy-3-methylphenyl)-2-methylphenyl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | [4-(4-ethoxy-3-methylphenyl)-2-methylphenyl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 67435954 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | [4-(4-ethoxy-3-methylphenyl)-2-methylphenyl]-(3-pyridin-3-ylpyrrolidin-1-yl)methanone |
| SMILES | CCOc1ccc(-c2ccc(C(=O)N3CCC(c4cccnc4)C3)c(C)c2)cc1C |
| InChI | InChI=1S/C26H28N2O2/c1-4-30-25-10-8-21(15-19(25)3)20-7-9-24(18(2)14-20)26(29)28-13-11-23(17-28)22-6-5-12-27-16-22/h5-10,12,14-16,23H,4,11,13,17H2,1-3H3 |
| InChIKey | UAUQGIWNTKHJKK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |