C18H27NO3 — CID 169498705
tert-butyl 3-(4-ethoxy-3-methylphenyl)pyrrolidine-1-carboxylate (PubChem CID 169498705) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl 3-(4-ethoxy-3-methylphenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-ethoxy-3-methylphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 169498705 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl 3-(4-ethoxy-3-methylphenyl)pyrrolidine-1-carboxylate |
| SMILES | CCOc1ccc(C2CCN(C(=O)OC(C)(C)C)C2)cc1C |
| InChI | InChI=1S/C18H27NO3/c1-6-21-16-8-7-14(11-13(16)2)15-9-10-19(12-15)17(20)22-18(3,4)5/h7-8,11,15H,6,9-10,12H2,1-5H3 |
| InChIKey | VHGWXPOCUMPNGV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |