C21H31NO4 — CID 11726110
tert-butyl 3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1-carboxylate (PubChem CID 11726110) has the molecular formula C21H31NO4 and a molecular weight of 361.48 g/mol. Its IUPAC name is tert-butyl 3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11726110 |
| Molecular Formula | C21H31NO4 |
| Molecular Weight | 361.48 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl 3-(3-cyclopentyloxy-4-methoxyphenyl)pyrrolidine-1-carboxylate |
| SMILES | COc1ccc(C2CCN(C(=O)OC(C)(C)C)C2)cc1OC1CCCC1 |
| InChI | InChI=1S/C21H31NO4/c1-21(2,3)26-20(23)22-12-11-16(14-22)15-9-10-18(24-4)19(13-15)25-17-7-5-6-8-17/h9-10,13,16-17H,5-8,11-12,14H2,1-4H3 |
| InChIKey | NWKASZAWLUVLME-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |