C26H24N4O — CID 46190523
(1-cyclopropyl-2-phenylbenzimidazol-5-yl)-(3-pyridin-3-ylpyrrolidin-1-yl)methanone (PubChem CID 46190523) has the molecular formula C26H24N4O and a molecular weight of 408.50 g/mol. Its IUPAC name is (1-cyclopropyl-2-phenylbenzimidazol-5-yl)-(3-pyridin-3-ylpyrrolidin-1-yl)methanone.
| Compound Name | (1-cyclopropyl-2-phenylbenzimidazol-5-yl)-(3-pyridin-3-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 46190523 |
| Molecular Formula | C26H24N4O |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (1-cyclopropyl-2-phenylbenzimidazol-5-yl)-(3-pyridin-3-ylpyrrolidin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)nc(-c1ccccc1)n2C1CC1)N1CCC(c2cccnc2)C1 |
| InChI | InChI=1S/C26H24N4O/c31-26(29-14-12-21(17-29)20-7-4-13-27-16-20)19-8-11-24-23(15-19)28-25(30(24)22-9-10-22)18-5-2-1-3-6-18/h1-8,11,13,15-16,21-22H,9-10,12,14,17H2 |
| InChIKey | VVGXQAYLUZSOJU-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |