C11H14N2O2 — CID 59581393
1-(3-pyridin-3-yloxypyrrolidin-1-yl)ethanone (PubChem CID 59581393) has the molecular formula C11H14N2O2 and a molecular weight of 206.25 g/mol. Its IUPAC name is 1-(3-pyridin-3-yloxypyrrolidin-1-yl)ethanone.
| Compound Name | 1-(3-pyridin-3-yloxypyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 59581393 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 1-(3-pyridin-3-yloxypyrrolidin-1-yl)ethanone |
| SMILES | CC(=O)N1CCC(Oc2cccnc2)C1 |
| InChI | InChI=1S/C11H14N2O2/c1-9(14)13-6-4-11(8-13)15-10-3-2-5-12-7-10/h2-3,5,7,11H,4,6,8H2,1H3 |
| InChIKey | KUPDWGYKCRAMNW-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |