C15H16N4O2 — CID 97084803
(3S)-N-pyridin-2-yl-3-pyridin-3-yloxypyrrolidine-1-carboxamide (PubChem CID 97084803) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is (3S)-N-pyridin-2-yl-3-pyridin-3-yloxypyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-pyridin-2-yl-3-pyridin-3-yloxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 97084803 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (3S)-N-pyridin-2-yl-3-pyridin-3-yloxypyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccn1)N1CC[C@H](Oc2cccnc2)C1 |
| InChI | InChI=1S/C15H16N4O2/c20-15(18-14-5-1-2-8-17-14)19-9-6-13(11-19)21-12-4-3-7-16-10-12/h1-5,7-8,10,13H,6,9,11H2,(H,17,18,20)/t13-/m0/s1 |
| InChIKey | LRXNYYMGUKSSKI-ZDUSSCGKSA-N |
| XLogP | 2.16 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |