C11H13N3 — CID 67821180
(2S)-1-methyl-2-pyridin-3-ylpyrrolidine-3-carbonitrile (PubChem CID 67821180) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is (2S)-1-methyl-2-pyridin-3-ylpyrrolidine-3-carbonitrile.
| Compound Name | (2S)-1-methyl-2-pyridin-3-ylpyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 67821180 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | (2S)-1-methyl-2-pyridin-3-ylpyrrolidine-3-carbonitrile |
| SMILES | CN1CCC(C#N)[C@H]1c1cccnc1 |
| InChI | InChI=1S/C11H13N3/c1-14-6-4-9(7-12)11(14)10-3-2-5-13-8-10/h2-3,5,8-9,11H,4,6H2,1H3/t9?,11-/m0/s1 |
| InChIKey | ASFKOKCKTGIGNO-UMJHXOGRSA-N |
| XLogP | 1.60 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |