C13H19N2+ — CID 154957691
3-[(2S)-1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-2-yl]pyridine (PubChem CID 154957691) has the molecular formula C13H19N2+ and a molecular weight of 203.31 g/mol. Its IUPAC name is 3-[(2S)-1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-2-yl]pyridine.
| Compound Name | 3-[(2S)-1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-2-yl]pyridine |
|---|---|
| PubChem CID | 154957691 |
| Molecular Formula | C13H19N2+ |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 3-[(2S)-1-ethyl-1-methyl-3,6-dihydro-2H-pyridin-1-ium-2-yl]pyridine |
| SMILES | CC[N+]1(C)CC=CC[C@H]1c1cccnc1 |
| InChI | InChI=1S/C13H19N2/c1-3-15(2)10-5-4-8-13(15)12-7-6-9-14-11-12/h4-7,9,11,13H,3,8,10H2,1-2H3/q+1/t13-,15?/m0/s1 |
| InChIKey | HGYKWERCSUJVBB-CFMCSPIPSA-N |
| XLogP | 2.55 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|