C10H11NOS — CID 102174831
2-pyridin-3-yl-3,6-dihydro-2H-thiopyran 1-oxide (PubChem CID 102174831) has the molecular formula C10H11NOS and a molecular weight of 193.27 g/mol. Its IUPAC name is 2-pyridin-3-yl-3,6-dihydro-2H-thiopyran 1-oxide.
| Compound Name | 2-pyridin-3-yl-3,6-dihydro-2H-thiopyran 1-oxide |
|---|---|
| PubChem CID | 102174831 |
| Molecular Formula | C10H11NOS |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.06 |
| IUPAC Name | 2-pyridin-3-yl-3,6-dihydro-2H-thiopyran 1-oxide |
| SMILES | O=S1CC=CCC1c1cccnc1 |
| InChI | InChI=1S/C10H11NOS/c12-13-7-2-1-5-10(13)9-4-3-6-11-8-9/h1-4,6,8,10H,5,7H2 |
| InChIKey | FOADNLXRHCRPBT-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|