About 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine
2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine (PubChem CID 14893331) has the molecular formula C13H12N2O
and a molecular weight of 212.25 g/mol. Its IUPAC name is 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine.
Molecular Properties
| Compound Name | 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine |
| PubChem CID | 14893331 |
| Molecular Formula | C13H12N2O |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine |
| SMILES | c1cncc(C2Nc3ccccc3CO2)c1 |
| InChI | InChI=1S/C13H12N2O/c1-2-6-12-11(4-1)9-16-13(15-12)10-5-3-7-14-8-10/h1-8,13,15H,9H2 |
| InChIKey | OTXBKWRXFUQHSL-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine?
The IUPAC name of 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine (CID 14893331) is 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine.
What is the SMILES notation for 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine?
The canonical SMILES for 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine is c1cncc(C2Nc3ccccc3CO2)c1.
What is the InChIKey of 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine?
The InChIKey is OTXBKWRXFUQHSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O/c1-2-6-12-11(4-1)9-16-13(15-12)10-5-3-7-14-8-10/h1-8,13,15H,9H2.
What are the key properties of 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine?
2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine has a molecular weight of 212.25 g/mol, XLogP of 2.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-3-yl-2,4-dihydro-1H-3,1-benzoxazine is sourced from PubChem (CID 14893331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).