C17H14N2O — CID 43818980
2-quinolin-4-yl-2,4-dihydro-1H-3,1-benzoxazine (PubChem CID 43818980) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is 2-quinolin-4-yl-2,4-dihydro-1H-3,1-benzoxazine.
| Compound Name | 2-quinolin-4-yl-2,4-dihydro-1H-3,1-benzoxazine |
|---|---|
| PubChem CID | 43818980 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-quinolin-4-yl-2,4-dihydro-1H-3,1-benzoxazine |
| SMILES | c1ccc2c(c1)COC(c1ccnc3ccccc13)N2 |
| InChI | InChI=1S/C17H14N2O/c1-3-7-15-12(5-1)11-20-17(19-15)14-9-10-18-16-8-4-2-6-13(14)16/h1-10,17,19H,11H2 |
| InChIKey | PULAZGOMJZYJQP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |