About 2,4-dihydro-1H-3,1-benzoxazin-2-ol
2,4-dihydro-1H-3,1-benzoxazin-2-ol (PubChem CID 90839695) has the molecular formula C8H9NO2
and a molecular weight of 151.16 g/mol. Its IUPAC name is 2,4-dihydro-1H-3,1-benzoxazin-2-ol.
Molecular Properties
| Compound Name | 2,4-dihydro-1H-3,1-benzoxazin-2-ol |
| PubChem CID | 90839695 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 2,4-dihydro-1H-3,1-benzoxazin-2-ol |
| SMILES | OC1Nc2ccccc2CO1 |
| InChI | InChI=1S/C8H9NO2/c10-8-9-7-4-2-1-3-6(7)5-11-8/h1-4,8-10H,5H2 |
| InChIKey | KVCAOKWEQZMOAS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dihydro-1H-3,1-benzoxazin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydro-1H-3,1-benzoxazin-2-ol?
The IUPAC name of 2,4-dihydro-1H-3,1-benzoxazin-2-ol (CID 90839695) is 2,4-dihydro-1H-3,1-benzoxazin-2-ol.
What is the SMILES notation for 2,4-dihydro-1H-3,1-benzoxazin-2-ol?
The canonical SMILES for 2,4-dihydro-1H-3,1-benzoxazin-2-ol is OC1Nc2ccccc2CO1.
What is the InChIKey of 2,4-dihydro-1H-3,1-benzoxazin-2-ol?
The InChIKey is KVCAOKWEQZMOAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c10-8-9-7-4-2-1-3-6(7)5-11-8/h1-4,8-10H,5H2.
What are the key properties of 2,4-dihydro-1H-3,1-benzoxazin-2-ol?
2,4-dihydro-1H-3,1-benzoxazin-2-ol has a molecular weight of 151.16 g/mol, XLogP of 0.90, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydro-1H-3,1-benzoxazin-2-ol is sourced from PubChem (CID 90839695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).