C17H16N2O — CID 174436301
bis(2,3-dihydro-1H-indol-2-yl)methanone (PubChem CID 174436301) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is bis(2,3-dihydro-1H-indol-2-yl)methanone.
| Compound Name | bis(2,3-dihydro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 174436301 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | bis(2,3-dihydro-1H-indol-2-yl)methanone |
| SMILES | O=C(C1Cc2ccccc2N1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C17H16N2O/c20-17(15-9-11-5-1-3-7-13(11)18-15)16-10-12-6-2-4-8-14(12)19-16/h1-8,15-16,18-19H,9-10H2 |
| InChIKey | MWMCQHBIDOVTAC-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |