C15H12ClNO — CID 116596841
(4-chlorophenyl)-(2,3-dihydro-1H-indol-2-yl)methanone (PubChem CID 116596841) has the molecular formula C15H12ClNO and a molecular weight of 257.72 g/mol. Its IUPAC name is (4-chlorophenyl)-(2,3-dihydro-1H-indol-2-yl)methanone.
| Compound Name | (4-chlorophenyl)-(2,3-dihydro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 116596841 |
| Molecular Formula | C15H12ClNO |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | (4-chlorophenyl)-(2,3-dihydro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1ccc(Cl)cc1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H12ClNO/c16-12-7-5-10(6-8-12)15(18)14-9-11-3-1-2-4-13(11)17-14/h1-8,14,17H,9H2 |
| InChIKey | AVSUHGLWOHXARW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |