C14H12ClN3O — CID 76892365
N-(5-chloro-2-pyridinyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76892365) has the molecular formula C14H12ClN3O and a molecular weight of 273.72 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76892365 |
| Molecular Formula | C14H12ClN3O |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cn1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C14H12ClN3O/c15-10-5-6-13(16-8-10)18-14(19)12-7-9-3-1-2-4-11(9)17-12/h1-6,8,12,17H,7H2,(H,16,18,19) |
| InChIKey | MOJBLHCNKBVEJL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |