C15H12Cl2N2O — CID 46216647
N-(3,5-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 46216647) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 46216647 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H12Cl2N2O/c16-10-6-11(17)8-12(7-10)18-15(20)14-5-9-3-1-2-4-13(9)19-14/h1-4,6-8,14,19H,5H2,(H,18,20) |
| InChIKey | JYXGYSGOQZMVJL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |