C15H12Cl2N2O — CID 61148394
(2S)-N-(2,3-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 61148394) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is (2S)-N-(2,3-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-(2,3-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 61148394 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (2S)-N-(2,3-dichlorophenyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1Cl)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H12Cl2N2O/c16-10-5-3-7-12(14(10)17)19-15(20)13-8-9-4-1-2-6-11(9)18-13/h1-7,13,18H,8H2,(H,19,20)/t13-/m0/s1 |
| InChIKey | JFRZNCBGKFNDNO-ZDUSSCGKSA-N |
| XLogP | 3.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |