C15H12N4OSe — CID 61179668
(2S)-N-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 61179668) has the molecular formula C15H12N4OSe and a molecular weight of 343.25 g/mol. Its IUPAC name is (2S)-N-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 61179668 |
| Molecular Formula | C15H12N4OSe |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | (2S)-N-(8λ4-selena-7,9-diazabicyclo[4.3.0]nona-1(6),2,4,7,8-pentaen-2-yl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1cccc2c1N=[Se]=N2)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H12N4OSe/c20-15(13-8-9-4-1-2-5-10(9)16-13)17-11-6-3-7-12-14(11)19-21-18-12/h1-7,13,16H,8H2,(H,17,20)/t13-/m0/s1 |
| InChIKey | DHBNCIUYMRWRBM-ZDUSSCGKSA-N |
| XLogP | 3.01 |
| TPSA | 65.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|