C17H16N2O3 — CID 110861590
methyl 2-(2,3-dihydro-1H-indole-2-carbonylamino)benzoate (PubChem CID 110861590) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is methyl 2-(2,3-dihydro-1H-indole-2-carbonylamino)benzoate.
| Compound Name | methyl 2-(2,3-dihydro-1H-indole-2-carbonylamino)benzoate |
|---|---|
| PubChem CID | 110861590 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 2-(2,3-dihydro-1H-indole-2-carbonylamino)benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C17H16N2O3/c1-22-17(21)12-7-3-5-9-14(12)19-16(20)15-10-11-6-2-4-8-13(11)18-15/h2-9,15,18H,10H2,1H3,(H,19,20) |
| InChIKey | IYBJINBBJYJYEP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |