C17H18N2O3 — CID 110860613
N-(2,4-dimethoxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 110860613) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110860613 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)C2Cc3ccccc3N2)c(OC)c1 |
| InChI | InChI=1S/C17H18N2O3/c1-21-12-7-8-14(16(10-12)22-2)19-17(20)15-9-11-5-3-4-6-13(11)18-15/h3-8,10,15,18H,9H2,1-2H3,(H,19,20) |
| InChIKey | HBDZANIMHNSQJE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |