C15H13BrN2O2 — CID 81495794
(2S)-N-(3-bromo-2-hydroxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 81495794) has the molecular formula C15H13BrN2O2 and a molecular weight of 333.19 g/mol. Its IUPAC name is (2S)-N-(3-bromo-2-hydroxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-(3-bromo-2-hydroxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 81495794 |
| Molecular Formula | C15H13BrN2O2 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | (2S)-N-(3-bromo-2-hydroxyphenyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1cccc(Br)c1O)[C@@H]1Cc2ccccc2N1 |
| InChI | InChI=1S/C15H13BrN2O2/c16-10-5-3-7-12(14(10)19)18-15(20)13-8-9-4-1-2-6-11(9)17-13/h1-7,13,17,19H,8H2,(H,18,20)/t13-/m0/s1 |
| InChIKey | ZYMUKIRBJUZDSO-ZDUSSCGKSA-N |
| XLogP | 3.13 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|