C16H13N3O — CID 61148170
(2S)-N-(4-cyanophenyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 61148170) has the molecular formula C16H13N3O and a molecular weight of 263.30 g/mol. Its IUPAC name is (2S)-N-(4-cyanophenyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | (2S)-N-(4-cyanophenyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 61148170 |
| Molecular Formula | C16H13N3O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (2S)-N-(4-cyanophenyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | N#Cc1ccc(NC(=O)[C@@H]2Cc3ccccc3N2)cc1 |
| InChI | InChI=1S/C16H13N3O/c17-10-11-5-7-13(8-6-11)18-16(20)15-9-12-3-1-2-4-14(12)19-15/h1-8,15,19H,9H2,(H,18,20)/t15-/m0/s1 |
| InChIKey | JCXBBLAIUCBFDC-HNNXBMFYSA-N |
| XLogP | 2.53 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |