C17H15N3O — CID 76887453
N-[(3-cyanophenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76887453) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is N-[(3-cyanophenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-[(3-cyanophenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76887453 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | N-[(3-cyanophenyl)methyl]-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | N#Cc1cccc(CNC(=O)C2Cc3ccccc3N2)c1 |
| InChI | InChI=1S/C17H15N3O/c18-10-12-4-3-5-13(8-12)11-19-17(21)16-9-14-6-1-2-7-15(14)20-16/h1-8,16,20H,9,11H2,(H,19,21) |
| InChIKey | JTIKCOKAEYVANA-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |