C13H12N2OS — CID 77126351
N-thiophen-3-yl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 77126351) has the molecular formula C13H12N2OS and a molecular weight of 244.32 g/mol. Its IUPAC name is N-thiophen-3-yl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-thiophen-3-yl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 77126351 |
| Molecular Formula | C13H12N2OS |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | N-thiophen-3-yl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccsc1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C13H12N2OS/c16-13(14-10-5-6-17-8-10)12-7-9-3-1-2-4-11(9)15-12/h1-6,8,12,15H,7H2,(H,14,16) |
| InChIKey | BHYCVPALRKQHIM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |