C14H14N2OS — CID 76988868
N-(thiophen-3-ylmethyl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76988868) has the molecular formula C14H14N2OS and a molecular weight of 258.35 g/mol. Its IUPAC name is N-(thiophen-3-ylmethyl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(thiophen-3-ylmethyl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76988868 |
| Molecular Formula | C14H14N2OS |
| Molecular Weight | 258.35 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | N-(thiophen-3-ylmethyl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccsc1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C14H14N2OS/c17-14(15-8-10-5-6-18-9-10)13-7-11-3-1-2-4-12(11)16-13/h1-6,9,13,16H,7-8H2,(H,15,17) |
| InChIKey | OYYINAHSBZFZSX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |