C12H11N3O2 — CID 76977109
N-(1,2-oxazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76977109) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is N-(1,2-oxazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(1,2-oxazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76977109 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-(1,2-oxazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1cnoc1)C1Cc2ccccc2N1 |
| InChI | InChI=1S/C12H11N3O2/c16-12(14-9-6-13-17-7-9)11-5-8-3-1-2-4-10(8)15-11/h1-4,6-7,11,15H,5H2,(H,14,16) |
| InChIKey | KSUVNHLGKMDZEI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |