C14H16N4O — CID 76893175
N-(1-ethylpyrazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 76893175) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is N-(1-ethylpyrazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(1-ethylpyrazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 76893175 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | N-(1-ethylpyrazol-4-yl)-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | CCn1cc(NC(=O)C2Cc3ccccc3N2)cn1 |
| InChI | InChI=1S/C14H16N4O/c1-2-18-9-11(8-15-18)16-14(19)13-7-10-5-3-4-6-12(10)17-13/h3-6,8-9,13,17H,2,7H2,1H3,(H,16,19) |
| InChIKey | AXGLYOFECXOETA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |